C17H26N2O4 — CID 100701491
(2R)-N-[4-(2-amino-2-oxoethoxy)phenyl]-2-methoxy-2-methylheptanamide (PubChem CID 100701491) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is (2R)-N-[4-(2-amino-2-oxoethoxy)phenyl]-2-methoxy-2-methylheptanamide.
| Compound Name | (2R)-N-[4-(2-amino-2-oxoethoxy)phenyl]-2-methoxy-2-methylheptanamide |
|---|---|
| PubChem CID | 100701491 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (2R)-N-[4-(2-amino-2-oxoethoxy)phenyl]-2-methoxy-2-methylheptanamide |
| SMILES | CCCCC[C@@](C)(OC)C(=O)Nc1ccc(OCC(N)=O)cc1 |
| InChI | InChI=1S/C17H26N2O4/c1-4-5-6-11-17(2,22-3)16(21)19-13-7-9-14(10-8-13)23-12-15(18)20/h7-10H,4-6,11-12H2,1-3H3,(H2,18,20)(H,19,21)/t17-/m1/s1 |
| InChIKey | AFPWHEWGRRTDFO-QGZVFWFLSA-N |
| XLogP | 2.47 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|