C23H24N4OS2 — CID 100701997
N-(2,5-dimethylphenyl)-3-[(4S,5S)-4-pyridin-2-yl-2-sulfanylidene-5-thiophen-2-ylimidazolidin-1-yl]propanamide (PubChem CID 100701997) has the molecular formula C23H24N4OS2 and a molecular weight of 436.61 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-3-[(4S,5S)-4-pyridin-2-yl-2-sulfanylidene-5-thiophen-2-ylimidazolidin-1-yl]propanamide.
| Compound Name | N-(2,5-dimethylphenyl)-3-[(4S,5S)-4-pyridin-2-yl-2-sulfanylidene-5-thiophen-2-ylimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100701997 |
| Molecular Formula | C23H24N4OS2 |
| Molecular Weight | 436.61 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-(2,5-dimethylphenyl)-3-[(4S,5S)-4-pyridin-2-yl-2-sulfanylidene-5-thiophen-2-ylimidazolidin-1-yl]propanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCN2C(=S)N[C@H](c3ccccn3)[C@H]2c2cccs2)c1 |
| InChI | InChI=1S/C23H24N4OS2/c1-15-8-9-16(2)18(14-15)25-20(28)10-12-27-22(19-7-5-13-30-19)21(26-23(27)29)17-6-3-4-11-24-17/h3-9,11,13-14,21-22H,10,12H2,1-2H3,(H,25,28)(H,26,29)/t21-,22-/m1/s1 |
| InChIKey | OIRPVQFGAGNHBR-FGZHOGPDSA-N |
| XLogP | 4.76 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|