C21H21N3O4S — CID 10070206
5-[[4-[3-[1,3-benzoxazol-2-yl(methyl)amino]propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 10070206) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is 5-[[4-[3-[1,3-benzoxazol-2-yl(methyl)amino]propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[3-[1,3-benzoxazol-2-yl(methyl)amino]propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10070206 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 5-[[4-[3-[1,3-benzoxazol-2-yl(methyl)amino]propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(CCCOc1ccc(CC2SC(=O)NC2=O)cc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C21H21N3O4S/c1-24(20-22-16-5-2-3-6-17(16)28-20)11-4-12-27-15-9-7-14(8-10-15)13-18-19(25)23-21(26)29-18/h2-3,5-10,18H,4,11-13H2,1H3,(H,23,25,26) |
| InChIKey | DWPTVWXVZBYAIW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|