C22H29N5O3 — CID 10070215
8-(cyclohexylamino)-1,3-diethyl-7-[(4-hydroxyphenyl)methyl]purine-2,6-dione (PubChem CID 10070215) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 8-(cyclohexylamino)-1,3-diethyl-7-[(4-hydroxyphenyl)methyl]purine-2,6-dione.
| Compound Name | 8-(cyclohexylamino)-1,3-diethyl-7-[(4-hydroxyphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 10070215 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 8-(cyclohexylamino)-1,3-diethyl-7-[(4-hydroxyphenyl)methyl]purine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(NC3CCCCC3)n2Cc2ccc(O)cc2)n(CC)c1=O |
| InChI | InChI=1S/C22H29N5O3/c1-3-25-19-18(20(29)26(4-2)22(25)30)27(14-15-10-12-17(28)13-11-15)21(24-19)23-16-8-6-5-7-9-16/h10-13,16,28H,3-9,14H2,1-2H3,(H,23,24) |
| InChIKey | REXDABZXHFOGCH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |