About (3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one
(3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one (PubChem CID 100703913) has the molecular formula C15H28N2O2
and a molecular weight of 268.40 g/mol. Its IUPAC name is (3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one.
Molecular Properties
| Compound Name | (3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one |
| PubChem CID | 100703913 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | (3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one |
| SMILES | C[C@H]1C(=O)N(C)CCN1CCCCC1CCOCC1 |
| InChI | InChI=1S/C15H28N2O2/c1-13-15(18)16(2)9-10-17(13)8-4-3-5-14-6-11-19-12-7-14/h13-14H,3-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | UEFRLNSBKFGCFW-ZDUSSCGKSA-N |
| XLogP | 1.75 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one?
The IUPAC name of (3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one (CID 100703913) is (3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one.
What is the SMILES notation for (3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one?
The canonical SMILES for (3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one is C[C@H]1C(=O)N(C)CCN1CCCCC1CCOCC1.
What is the InChIKey of (3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one?
The InChIKey is UEFRLNSBKFGCFW-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H28N2O2/c1-13-15(18)16(2)9-10-17(13)8-4-3-5-14-6-11-19-12-7-14/h13-14H,3-12H2,1-2H3/t13-/m0/s1.
What are the key properties of (3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one?
(3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one has a molecular weight of 268.40 g/mol, XLogP of 1.75, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,3-dimethyl-4-[4-(oxan-4-yl)butyl]piperazin-2-one is sourced from PubChem (CID 100703913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).