C26H26N2OS — CID 10070418
(Z,4S)-2-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]-4-phenyl-4-phenylsulfanylbut-2-enenitrile (PubChem CID 10070418) has the molecular formula C26H26N2OS and a molecular weight of 414.57 g/mol. Its IUPAC name is (Z,4S)-2-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]-4-phenyl-4-phenylsulfanylbut-2-enenitrile.
| Compound Name | (Z,4S)-2-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]-4-phenyl-4-phenylsulfanylbut-2-enenitrile |
|---|---|
| PubChem CID | 10070418 |
| Molecular Formula | C26H26N2OS |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (Z,4S)-2-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]-4-phenyl-4-phenylsulfanylbut-2-enenitrile |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)N(C)/C(C#N)=C\[C@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26N2OS/c1-20(26(29)22-14-8-4-9-15-22)28(2)23(19-27)18-25(21-12-6-3-7-13-21)30-24-16-10-5-11-17-24/h3-18,20,25-26,29H,1-2H3/b23-18-/t20-,25-,26-/m0/s1 |
| InChIKey | NZLQLVNNXBHWQZ-RPJJFJNCSA-N |
| XLogP | 5.98 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|