About 3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea
3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea (PubChem CID 10070459) has the molecular formula C26H29N3O2
and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea.
Molecular Properties
| Compound Name | 3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea |
| PubChem CID | 10070459 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29N3O2/c1-18(2)22-16-11-17-23(19(3)4)24(22)27-25(30)28-26(31)29(20-12-7-5-8-13-20)21-14-9-6-10-15-21/h5-19H,1-4H3,(H2,27,28,30,31) |
| InChIKey | MANKFQZSIMWMCK-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea?
The IUPAC name of 3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea (CID 10070459) is 3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea.
What is the SMILES notation for 3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea?
The canonical SMILES for 3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea is CC(C)c1cccc(C(C)C)c1NC(=O)NC(=O)N(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea?
The InChIKey is MANKFQZSIMWMCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29N3O2/c1-18(2)22-16-11-17-23(19(3)4)24(22)27-25(30)28-26(31)29(20-12-7-5-8-13-20)21-14-9-6-10-15-21/h5-19H,1-4H3,(H2,27,28,30,31).
What are the key properties of 3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea?
3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea has a molecular weight of 415.54 g/mol, XLogP of 7.01, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-1,1-diphenylurea is sourced from PubChem (CID 10070459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).