C20H29N3O2 — CID 100705133
(1S)-1-(furan-3-yl)-4-methyl-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]pentan-1-amine (PubChem CID 100705133) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (1S)-1-(furan-3-yl)-4-methyl-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]pentan-1-amine.
| Compound Name | (1S)-1-(furan-3-yl)-4-methyl-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 100705133 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (1S)-1-(furan-3-yl)-4-methyl-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]pentan-1-amine |
| SMILES | CC(C)CC[C@H](NCc1cccnc1N1CCOCC1)c1ccoc1 |
| InChI | InChI=1S/C20H29N3O2/c1-16(2)5-6-19(18-7-11-25-15-18)22-14-17-4-3-8-21-20(17)23-9-12-24-13-10-23/h3-4,7-8,11,15-16,19,22H,5-6,9-10,12-14H2,1-2H3/t19-/m0/s1 |
| InChIKey | VCRFXZCPTHJABP-IBGZPJMESA-N |
| XLogP | 3.78 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |