C29H28N6O3S — CID 100706436
N-(2,5-dimethylphenyl)-3-[(4R,5R)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide (PubChem CID 100706436) has the molecular formula C29H28N6O3S and a molecular weight of 540.65 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-3-[(4R,5R)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide.
| Compound Name | N-(2,5-dimethylphenyl)-3-[(4R,5R)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100706436 |
| Molecular Formula | C29H28N6O3S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | N-(2,5-dimethylphenyl)-3-[(4R,5R)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCN2C(=S)N[C@@H](c3ccccn3)[C@@H]2c2cccn2-c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C29H28N6O3S/c1-19-8-9-20(2)24(18-19)31-26(36)14-17-34-28(27(32-29(34)39)23-6-3-4-15-30-23)25-7-5-16-33(25)21-10-12-22(13-11-21)35(37)38/h3-13,15-16,18,27-28H,14,17H2,1-2H3,(H,31,36)(H,32,39)/t27-,28-/m0/s1 |
| InChIKey | PISARYVYZUXWTO-NSOVKSMOSA-N |
| XLogP | 5.40 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|