About 4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline
4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline (PubChem CID 10070722) has the molecular formula C28H37NO2
and a molecular weight of 419.61 g/mol. Its IUPAC name is 4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline.
Molecular Properties
| Compound Name | 4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline |
| PubChem CID | 10070722 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline |
| SMILES | COc1ccccc1-c1ccc2c(c1)C(C(C)OCCC1CCCCC1)=CC(C)(C)N2 |
| InChI | InChI=1S/C28H37NO2/c1-20(31-17-16-21-10-6-5-7-11-21)25-19-28(2,3)29-26-15-14-22(18-24(25)26)23-12-8-9-13-27(23)30-4/h8-9,12-15,18-21,29H,5-7,10-11,16-17H2,1-4H3 |
| InChIKey | ZWZZCNSUUOQZFI-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline?
The IUPAC name of 4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline (CID 10070722) is 4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline.
What is the SMILES notation for 4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline?
The canonical SMILES for 4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline is COc1ccccc1-c1ccc2c(c1)C(C(C)OCCC1CCCCC1)=CC(C)(C)N2.
What is the InChIKey of 4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline?
The InChIKey is ZWZZCNSUUOQZFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H37NO2/c1-20(31-17-16-21-10-6-5-7-11-21)25-19-28(2,3)29-26-15-14-22(18-24(25)26)23-12-8-9-13-27(23)30-4/h8-9,12-15,18-21,29H,5-7,10-11,16-17H2,1-4H3.
What are the key properties of 4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline?
4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline has a molecular weight of 419.61 g/mol, XLogP of 7.33, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2-cyclohexylethoxy)ethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline is sourced from PubChem (CID 10070722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).