C21H21FO6S — CID 10070743
(2S,3R,4R,5S,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-4-fluoro-2-hydroxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10070743) has the molecular formula C21H21FO6S and a molecular weight of 420.46 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-4-fluoro-2-hydroxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-4-fluoro-2-hydroxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10070743 |
| Molecular Formula | C21H21FO6S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-4-fluoro-2-hydroxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cc(Cc3cc4ccccc4s3)c(F)cc2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H21FO6S/c22-14-8-15(24)13(21-20(27)19(26)18(25)16(9-23)28-21)7-11(14)6-12-5-10-3-1-2-4-17(10)29-12/h1-5,7-8,16,18-21,23-27H,6,9H2/t16-,18-,19+,20-,21+/m1/s1 |
| InChIKey | VDJRUSPKUDRHQQ-RQXATKFSSA-N |
| XLogP | 1.85 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |