C23H20N2O4S — CID 10070754
ethyl (E)-3-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-cyanoprop-2-enoate (PubChem CID 10070754) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is ethyl (E)-3-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-cyanoprop-2-enoate.
| Compound Name | ethyl (E)-3-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 10070754 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | ethyl (E)-3-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1nc(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C23H20N2O4S/c1-4-29-23(26)17(14-24)13-20-25-21(15-5-9-18(27-2)10-6-15)22(30-20)16-7-11-19(28-3)12-8-16/h5-13H,4H2,1-3H3/b17-13+ |
| InChIKey | BAMBDOQUPBTCIJ-GHRIWEEISA-N |
| XLogP | 4.96 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|