About 2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine
2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine (PubChem CID 100707717) has the molecular formula C11H14N2S
and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine.
Molecular Properties
| Compound Name | 2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine |
| PubChem CID | 100707717 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine |
| SMILES | c1cnc(S[C@H]2C[C@H]3CC[C@H]2C3)cn1 |
| InChI | InChI=1S/C11H14N2S/c1-2-9-5-8(1)6-10(9)14-11-7-12-3-4-13-11/h3-4,7-10H,1-2,5-6H2/t8-,9-,10-/m0/s1 |
| InChIKey | UHQGBQUSBIUZDW-GUBZILKMSA-N |
| XLogP | 2.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine?
The IUPAC name of 2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine (CID 100707717) is 2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine.
What is the SMILES notation for 2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine?
The canonical SMILES for 2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine is c1cnc(S[C@H]2C[C@H]3CC[C@H]2C3)cn1.
What is the InChIKey of 2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine?
The InChIKey is UHQGBQUSBIUZDW-GUBZILKMSA-N. The full InChI is InChI=1S/C11H14N2S/c1-2-9-5-8(1)6-10(9)14-11-7-12-3-4-13-11/h3-4,7-10H,1-2,5-6H2/t8-,9-,10-/m0/s1.
What are the key properties of 2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine?
2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine has a molecular weight of 206.31 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfanyl]pyrazine is sourced from PubChem (CID 100707717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).