C33H35N5O3S — CID 100707758
methyl 2-[3-[(4R,5S)-3-[3-(2,5-dimethylanilino)-3-oxopropyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 100707758) has the molecular formula C33H35N5O3S and a molecular weight of 581.74 g/mol. Its IUPAC name is methyl 2-[3-[(4R,5S)-3-[3-(2,5-dimethylanilino)-3-oxopropyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | methyl 2-[3-[(4R,5S)-3-[3-(2,5-dimethylanilino)-3-oxopropyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 100707758 |
| Molecular Formula | C33H35N5O3S |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | methyl 2-[3-[(4R,5S)-3-[3-(2,5-dimethylanilino)-3-oxopropyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-n1c(C)cc([C@@H]2[C@@H](c3ccccn3)NC(=S)N2CCC(=O)Nc2cc(C)ccc2C)c1C |
| InChI | InChI=1S/C33H35N5O3S/c1-20-13-14-21(2)27(18-20)35-29(39)15-17-37-31(30(36-33(37)42)26-11-8-9-16-34-26)25-19-22(3)38(23(25)4)28-12-7-6-10-24(28)32(40)41-5/h6-14,16,18-19,30-31H,15,17H2,1-5H3,(H,35,39)(H,36,42)/t30-,31-/m1/s1 |
| InChIKey | YLRGJAPLFOKUHG-FIRIVFDPSA-N |
| XLogP | 5.89 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|