C13H17N5O3S3 — CID 100707929
4-[dimethylsulfamoyl(methyl)amino]-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 100707929) has the molecular formula C13H17N5O3S3 and a molecular weight of 387.51 g/mol. Its IUPAC name is 4-[dimethylsulfamoyl(methyl)amino]-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-[dimethylsulfamoyl(methyl)amino]-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 100707929 |
| Molecular Formula | C13H17N5O3S3 |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 4-[dimethylsulfamoyl(methyl)amino]-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CSc1nnc(NC(=O)c2ccc(N(C)S(=O)(=O)N(C)C)cc2)s1 |
| InChI | InChI=1S/C13H17N5O3S3/c1-17(2)24(20,21)18(3)10-7-5-9(6-8-10)11(19)14-12-15-16-13(22-4)23-12/h5-8H,1-4H3,(H,14,15,19) |
| InChIKey | KVDIRQWZLGMMNH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|