C18H27ClN2O2 — CID 100708064
(2S)-N-[(2R)-butan-2-yl]-2-[(4-chlorophenyl)methyl-propanoylamino]butanamide (PubChem CID 100708064) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is (2S)-N-[(2R)-butan-2-yl]-2-[(4-chlorophenyl)methyl-propanoylamino]butanamide.
| Compound Name | (2S)-N-[(2R)-butan-2-yl]-2-[(4-chlorophenyl)methyl-propanoylamino]butanamide |
|---|---|
| PubChem CID | 100708064 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (2S)-N-[(2R)-butan-2-yl]-2-[(4-chlorophenyl)methyl-propanoylamino]butanamide |
| SMILES | CCC(=O)N(Cc1ccc(Cl)cc1)[C@@H](CC)C(=O)N[C@H](C)CC |
| InChI | InChI=1S/C18H27ClN2O2/c1-5-13(4)20-18(23)16(6-2)21(17(22)7-3)12-14-8-10-15(19)11-9-14/h8-11,13,16H,5-7,12H2,1-4H3,(H,20,23)/t13-,16+/m1/s1 |
| InChIKey | OOKZXAWSKUXUAW-CJNGLKHVSA-N |
| XLogP | 3.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |