C22H24Cl5N3O4S — CID 100708379
(2S)-2-[(2,6-dichlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-propan-2-ylpropanamide (PubChem CID 100708379) has the molecular formula C22H24Cl5N3O4S and a molecular weight of 603.78 g/mol. Its IUPAC name is (2S)-2-[(2,6-dichlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | (2S)-2-[(2,6-dichlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 100708379 |
| Molecular Formula | C22H24Cl5N3O4S |
| Molecular Weight | 603.78 g/mol |
| Exact Mass | 600.99 |
| IUPAC Name | (2S)-2-[(2,6-dichlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)[C@H](C)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C22H24Cl5N3O4S/c1-12(2)28-22(32)13(3)29(10-14-15(23)6-5-7-16(14)24)21(31)11-30(35(4,33)34)20-9-18(26)17(25)8-19(20)27/h5-9,12-13H,10-11H2,1-4H3,(H,28,32)/t13-/m0/s1 |
| InChIKey | IZBKHTVYKSOKBA-ZDUSSCGKSA-N |
| XLogP | 5.66 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.78 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|