About 4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline
4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline (PubChem CID 10070842) has the molecular formula C25H24ClNOS
and a molecular weight of 421.99 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline.
Molecular Properties
| Compound Name | 4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline |
| PubChem CID | 10070842 |
| Molecular Formula | C25H24ClNOS |
| Molecular Weight | 421.99 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline |
| SMILES | COc1ccccc1-c1ccc2c(c1)C(CSc1ccc(Cl)cc1)=CC(C)(C)N2 |
| InChI | InChI=1S/C25H24ClNOS/c1-25(2)15-18(16-29-20-11-9-19(26)10-12-20)22-14-17(8-13-23(22)27-25)21-6-4-5-7-24(21)28-3/h4-15,27H,16H2,1-3H3 |
| InChIKey | DKLYGWOPRPJURQ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.99 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline?
The IUPAC name of 4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline (CID 10070842) is 4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline.
What is the SMILES notation for 4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline?
The canonical SMILES for 4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline is COc1ccccc1-c1ccc2c(c1)C(CSc1ccc(Cl)cc1)=CC(C)(C)N2.
What is the InChIKey of 4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline?
The InChIKey is DKLYGWOPRPJURQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24ClNOS/c1-25(2)15-18(16-29-20-11-9-19(26)10-12-20)22-14-17(8-13-23(22)27-25)21-6-4-5-7-24(21)28-3/h4-15,27H,16H2,1-3H3.
What are the key properties of 4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline?
4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline has a molecular weight of 421.99 g/mol, XLogP of 7.40, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-chlorophenyl)sulfanylmethyl]-6-(2-methoxyphenyl)-2,2-dimethyl-1H-quinoline is sourced from PubChem (CID 10070842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).