C22H23F3O5 — CID 10070976
(2R,4aR,6S,7S,8R,8aR)-7,8-dimethoxy-6-phenyl-2-[4-(trifluoromethyl)phenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 10070976) has the molecular formula C22H23F3O5 and a molecular weight of 424.42 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8R,8aR)-7,8-dimethoxy-6-phenyl-2-[4-(trifluoromethyl)phenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,7S,8R,8aR)-7,8-dimethoxy-6-phenyl-2-[4-(trifluoromethyl)phenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 10070976 |
| Molecular Formula | C22H23F3O5 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (2R,4aR,6S,7S,8R,8aR)-7,8-dimethoxy-6-phenyl-2-[4-(trifluoromethyl)phenyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](c2ccccc2)O[C@@H]2CO[C@@H](c3ccc(C(F)(F)F)cc3)O[C@@H]12 |
| InChI | InChI=1S/C22H23F3O5/c1-26-19-17(13-6-4-3-5-7-13)29-16-12-28-21(30-18(16)20(19)27-2)14-8-10-15(11-9-14)22(23,24)25/h3-11,16-21H,12H2,1-2H3/t16-,17+,18-,19+,20+,21-/m1/s1 |
| InChIKey | DCOIQFKJIWCCQG-ZWJPJJENSA-N |
| XLogP | 4.29 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |