About 1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide
1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide (PubChem CID 100710710) has the molecular formula C14H25NO2S
and a molecular weight of 271.43 g/mol. Its IUPAC name is 1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide |
| PubChem CID | 100710710 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide |
| SMILES | CCOCC1(C(=O)N[C@H]2CCC[C@H](SC)C2)CC1 |
| InChI | InChI=1S/C14H25NO2S/c1-3-17-10-14(7-8-14)13(16)15-11-5-4-6-12(9-11)18-2/h11-12H,3-10H2,1-2H3,(H,15,16)/t11-,12-/m0/s1 |
| InChIKey | JXTLMDJBMHKTAP-RYUDHWBXSA-N |
| XLogP | 2.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide?
The IUPAC name of 1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide (CID 100710710) is 1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide.
What is the SMILES notation for 1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide?
The canonical SMILES for 1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide is CCOCC1(C(=O)N[C@H]2CCC[C@H](SC)C2)CC1.
What is the InChIKey of 1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide?
The InChIKey is JXTLMDJBMHKTAP-RYUDHWBXSA-N. The full InChI is InChI=1S/C14H25NO2S/c1-3-17-10-14(7-8-14)13(16)15-11-5-4-6-12(9-11)18-2/h11-12H,3-10H2,1-2H3,(H,15,16)/t11-,12-/m0/s1.
What are the key properties of 1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide?
1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide has a molecular weight of 271.43 g/mol, XLogP of 2.59, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethoxymethyl)-N-[(1S,3S)-3-methylsulfanylcyclohexyl]cyclopropane-1-carboxamide is sourced from PubChem (CID 100710710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).