About 1-diethoxyphosphoryl-1,1-difluoro-3-iodononane
1-diethoxyphosphoryl-1,1-difluoro-3-iodononane (PubChem CID 10071090) has the molecular formula C13H26F2IO3P
and a molecular weight of 426.22 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1-difluoro-3-iodononane.
Molecular Properties
| Compound Name | 1-diethoxyphosphoryl-1,1-difluoro-3-iodononane |
| PubChem CID | 10071090 |
| Molecular Formula | C13H26F2IO3P |
| Molecular Weight | 426.22 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1-difluoro-3-iodononane |
| SMILES | CCCCCCC(I)CC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H26F2IO3P/c1-4-7-8-9-10-12(16)11-13(14,15)20(17,18-5-2)19-6-3/h12H,4-11H2,1-3H3 |
| InChIKey | BOBWQDCMXCZRMS-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.22 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diethoxyphosphoryl-1,1-difluoro-3-iodononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethoxyphosphoryl-1,1-difluoro-3-iodononane?
The IUPAC name of 1-diethoxyphosphoryl-1,1-difluoro-3-iodononane (CID 10071090) is 1-diethoxyphosphoryl-1,1-difluoro-3-iodononane.
What is the SMILES notation for 1-diethoxyphosphoryl-1,1-difluoro-3-iodononane?
The canonical SMILES for 1-diethoxyphosphoryl-1,1-difluoro-3-iodononane is CCCCCCC(I)CC(F)(F)P(=O)(OCC)OCC.
What is the InChIKey of 1-diethoxyphosphoryl-1,1-difluoro-3-iodononane?
The InChIKey is BOBWQDCMXCZRMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26F2IO3P/c1-4-7-8-9-10-12(16)11-13(14,15)20(17,18-5-2)19-6-3/h12H,4-11H2,1-3H3.
What are the key properties of 1-diethoxyphosphoryl-1,1-difluoro-3-iodononane?
1-diethoxyphosphoryl-1,1-difluoro-3-iodononane has a molecular weight of 426.22 g/mol, XLogP of 6.01, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethoxyphosphoryl-1,1-difluoro-3-iodononane is sourced from PubChem (CID 10071090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).