C16H20ClN3O2 — CID 100712520
(1S,2S,4S)-N-(6-chloro-3-pyridinyl)spiro[bicyclo[2.2.1]heptane-2,2'-morpholine]-4'-carboxamide (PubChem CID 100712520) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is (1S,2S,4S)-N-(6-chloro-3-pyridinyl)spiro[bicyclo[2.2.1]heptane-2,2'-morpholine]-4'-carboxamide.
| Compound Name | (1S,2S,4S)-N-(6-chloro-3-pyridinyl)spiro[bicyclo[2.2.1]heptane-2,2'-morpholine]-4'-carboxamide |
|---|---|
| PubChem CID | 100712520 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (1S,2S,4S)-N-(6-chloro-3-pyridinyl)spiro[bicyclo[2.2.1]heptane-2,2'-morpholine]-4'-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)nc1)N1CCO[C@]2(C[C@H]3CC[C@H]2C3)C1 |
| InChI | InChI=1S/C16H20ClN3O2/c17-14-4-3-13(9-18-14)19-15(21)20-5-6-22-16(10-20)8-11-1-2-12(16)7-11/h3-4,9,11-12H,1-2,5-8,10H2,(H,19,21)/t11-,12-,16+/m0/s1 |
| InChIKey | KAGGIVKUQFGAEM-MQIPJXDCSA-N |
| XLogP | 3.16 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|