C23H27ClN2O4 — CID 10071375
6-chloro-N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-oxochromene-3-carboxamide (PubChem CID 10071375) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is 6-chloro-N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-oxochromene-3-carboxamide.
| Compound Name | 6-chloro-N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 10071375 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 6-chloro-N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-oxochromene-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)N(C(=O)c1cc2cc(Cl)ccc2oc1=O)C1CCCCC1 |
| InChI | InChI=1S/C23H27ClN2O4/c24-16-11-12-20-15(13-16)14-19(22(28)30-20)21(27)26(18-9-5-2-6-10-18)23(29)25-17-7-3-1-4-8-17/h11-14,17-18H,1-10H2,(H,25,29) |
| InChIKey | SVWYOJDMPMQILY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|