C21H20F2N2O3 — CID 100713757
[3-(difluoromethoxy)phenyl]-[(3R)-3-(1H-indol-3-ylmethyl)morpholin-4-yl]methanone (PubChem CID 100713757) has the molecular formula C21H20F2N2O3 and a molecular weight of 386.40 g/mol. Its IUPAC name is [3-(difluoromethoxy)phenyl]-[(3R)-3-(1H-indol-3-ylmethyl)morpholin-4-yl]methanone.
| Compound Name | [3-(difluoromethoxy)phenyl]-[(3R)-3-(1H-indol-3-ylmethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 100713757 |
| Molecular Formula | C21H20F2N2O3 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [3-(difluoromethoxy)phenyl]-[(3R)-3-(1H-indol-3-ylmethyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1cccc(OC(F)F)c1)N1CCOC[C@H]1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H20F2N2O3/c22-21(23)28-17-5-3-4-14(11-17)20(26)25-8-9-27-13-16(25)10-15-12-24-19-7-2-1-6-18(15)19/h1-7,11-12,16,21,24H,8-10,13H2/t16-/m1/s1 |
| InChIKey | REGOCUSOBBJZJX-MRXNPFEDSA-N |
| XLogP | 3.85 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |