C22H26ClN3O4 — CID 100713816
(2S)-2-[(3-chlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-N-(2-methylpropyl)propanamide (PubChem CID 100713816) has the molecular formula C22H26ClN3O4 and a molecular weight of 431.92 g/mol. Its IUPAC name is (2S)-2-[(3-chlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-N-(2-methylpropyl)propanamide.
| Compound Name | (2S)-2-[(3-chlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 100713816 |
| Molecular Formula | C22H26ClN3O4 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | (2S)-2-[(3-chlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CNC(=O)[C@H](C)N(Cc1cccc(Cl)c1)C(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26ClN3O4/c1-15(2)13-24-22(28)16(3)25(14-17-7-6-9-19(23)11-17)21(27)12-18-8-4-5-10-20(18)26(29)30/h4-11,15-16H,12-14H2,1-3H3,(H,24,28)/t16-/m0/s1 |
| InChIKey | SSQQZKUMXNGEBA-INIZCTEOSA-N |
| XLogP | 3.98 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|