About 2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid
2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid (PubChem CID 10071509) has the molecular formula C17H17F2NO6S2
and a molecular weight of 433.45 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid |
| PubChem CID | 10071509 |
| Molecular Formula | C17H17F2NO6S2 |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid |
| SMILES | COc1ccc(S(=O)(=O)NCCSc2cc(F)c(OCC(=O)O)c(F)c2)cc1 |
| InChI | InChI=1S/C17H17F2NO6S2/c1-25-11-2-4-13(5-3-11)28(23,24)20-6-7-27-12-8-14(18)17(15(19)9-12)26-10-16(21)22/h2-5,8-9,20H,6-7,10H2,1H3,(H,21,22) |
| InChIKey | QOXUQFRRCFKSPH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid?
The IUPAC name of 2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid (CID 10071509) is 2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid.
What is the SMILES notation for 2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid?
The canonical SMILES for 2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid is COc1ccc(S(=O)(=O)NCCSc2cc(F)c(OCC(=O)O)c(F)c2)cc1.
What is the InChIKey of 2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid?
The InChIKey is QOXUQFRRCFKSPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2NO6S2/c1-25-11-2-4-13(5-3-11)28(23,24)20-6-7-27-12-8-14(18)17(15(19)9-12)26-10-16(21)22/h2-5,8-9,20H,6-7,10H2,1H3,(H,21,22).
What are the key properties of 2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid?
2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid has a molecular weight of 433.45 g/mol, XLogP of 2.51, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-difluoro-4-[2-[(4-methoxyphenyl)sulfonylamino]ethylsulfanyl]phenoxy]acetic acid is sourced from PubChem (CID 10071509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).