C21H31N5O5 — CID 10071520
(1R,2R,3S,4R,5S)-4-(1,3-dibutyl-2,6-dioxopurin-7-yl)-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 10071520) has the molecular formula C21H31N5O5 and a molecular weight of 433.51 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-4-(1,3-dibutyl-2,6-dioxopurin-7-yl)-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1R,2R,3S,4R,5S)-4-(1,3-dibutyl-2,6-dioxopurin-7-yl)-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 10071520 |
| Molecular Formula | C21H31N5O5 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (1R,2R,3S,4R,5S)-4-(1,3-dibutyl-2,6-dioxopurin-7-yl)-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | CCCCn1c(=O)c2c(ncn2[C@H]2[C@H](O)[C@H](O)[C@@]3(C(=O)NC)C[C@H]23)n(CCCC)c1=O |
| InChI | InChI=1S/C21H31N5O5/c1-4-6-8-24-17-14(18(29)25(20(24)31)9-7-5-2)26(11-23-17)13-12-10-21(12,19(30)22-3)16(28)15(13)27/h11-13,15-16,27-28H,4-10H2,1-3H3,(H,22,30)/t12-,13-,15+,16+,21-/m1/s1 |
| InChIKey | OIYNVBFLIZPDSF-WNIQIWDMSA-N |
| XLogP | -0.01 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |