C25H40O6 — CID 10071727
2-[(2R,5S,6S)-6-[(2E,4E)-7-(5-methoxy-2,4,6-trimethyl-3-oxooxan-2-yl)-6-methylhepta-2,4-dien-2-yl]-5-methyloxan-2-yl]acetic acid (PubChem CID 10071727) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is 2-[(2R,5S,6S)-6-[(2E,4E)-7-(5-methoxy-2,4,6-trimethyl-3-oxooxan-2-yl)-6-methylhepta-2,4-dien-2-yl]-5-methyloxan-2-yl]acetic acid.
| Compound Name | 2-[(2R,5S,6S)-6-[(2E,4E)-7-(5-methoxy-2,4,6-trimethyl-3-oxooxan-2-yl)-6-methylhepta-2,4-dien-2-yl]-5-methyloxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 10071727 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 2-[(2R,5S,6S)-6-[(2E,4E)-7-(5-methoxy-2,4,6-trimethyl-3-oxooxan-2-yl)-6-methylhepta-2,4-dien-2-yl]-5-methyloxan-2-yl]acetic acid |
| SMILES | COC1C(C)OC(C)(CC(C)/C=C/C=C(\C)[C@H]2O[C@@H](CC(=O)O)CC[C@@H]2C)C(=O)C1C |
| InChI | InChI=1S/C25H40O6/c1-15(14-25(6)24(28)18(4)23(29-7)19(5)31-25)9-8-10-16(2)22-17(3)11-12-20(30-22)13-21(26)27/h8-10,15,17-20,22-23H,11-14H2,1-7H3,(H,26,27)/b9-8+,16-10+/t15?,17-,18?,19?,20+,22+,23?,25?/m0/s1 |
| InChIKey | PXAVUDWRRLABCO-JKROCKHASA-N |
| XLogP | 4.57 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|