About [(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate
[(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate (PubChem CID 10071908) has the molecular formula C23H29N3O4Si
and a molecular weight of 439.59 g/mol. Its IUPAC name is [(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate.
Molecular Properties
| Compound Name | [(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate |
| PubChem CID | 10071908 |
| Molecular Formula | C23H29N3O4Si |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | [(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate |
| SMILES | CC(=O)OC1C[C@H](N=[N+]=[N-])[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H29N3O4Si/c1-17(27)29-22-15-20(25-26-24)21(30-22)16-28-31(23(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20-22H,15-16H2,1-4H3/t20-,21+,22?/m0/s1 |
| InChIKey | QZIAQOAUHPXIAL-UGGDCYSXSA-N |
| XLogP | 3.92 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate?
The IUPAC name of [(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate (CID 10071908) is [(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate.
What is the SMILES notation for [(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate?
The canonical SMILES for [(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate is CC(=O)OC1C[C@H](N=[N+]=[N-])[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1.
What is the InChIKey of [(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate?
The InChIKey is QZIAQOAUHPXIAL-UGGDCYSXSA-N. The full InChI is InChI=1S/C23H29N3O4Si/c1-17(27)29-22-15-20(25-26-24)21(30-22)16-28-31(23(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20-22H,15-16H2,1-4H3/t20-,21+,22?/m0/s1.
What are the key properties of [(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate?
[(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate has a molecular weight of 439.59 g/mol, XLogP of 3.92, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S,5S)-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl] acetate is sourced from PubChem (CID 10071908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).