C17H15F3N6O5 — CID 10071928
1-(2,2-dimethoxyethyl)-6-oxo-2-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]pyrimidine-5-carbonyl azide (PubChem CID 10071928) has the molecular formula C17H15F3N6O5 and a molecular weight of 440.34 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]pyrimidine-5-carbonyl azide.
| Compound Name | 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]pyrimidine-5-carbonyl azide |
|---|---|
| PubChem CID | 10071928 |
| Molecular Formula | C17H15F3N6O5 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]pyrimidine-5-carbonyl azide |
| SMILES | COC(Cn1c(-c2ccc(NC(=O)C(F)(F)F)cc2)ncc(C(=O)N=[N+]=[N-])c1=O)OC |
| InChI | InChI=1S/C17H15F3N6O5/c1-30-12(31-2)8-26-13(22-7-11(15(26)28)14(27)24-25-21)9-3-5-10(6-4-9)23-16(29)17(18,19)20/h3-7,12H,8H2,1-2H3,(H,23,29) |
| InChIKey | STTZLJWHHBNUBD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 148.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|