C18H21N3O5 — CID 100719629
1-[(3R)-3-(1,3-benzodioxol-5-yl)pyrrolidine-1-carbonyl]-4-ethylpiperazine-2,3-dione (PubChem CID 100719629) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 1-[(3R)-3-(1,3-benzodioxol-5-yl)pyrrolidine-1-carbonyl]-4-ethylpiperazine-2,3-dione.
| Compound Name | 1-[(3R)-3-(1,3-benzodioxol-5-yl)pyrrolidine-1-carbonyl]-4-ethylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 100719629 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-[(3R)-3-(1,3-benzodioxol-5-yl)pyrrolidine-1-carbonyl]-4-ethylpiperazine-2,3-dione |
| SMILES | CCN1CCN(C(=O)N2CC[C@H](c3ccc4c(c3)OCO4)C2)C(=O)C1=O |
| InChI | InChI=1S/C18H21N3O5/c1-2-19-7-8-21(17(23)16(19)22)18(24)20-6-5-13(10-20)12-3-4-14-15(9-12)26-11-25-14/h3-4,9,13H,2,5-8,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | KXLZUVFZXFINAW-ZDUSSCGKSA-N |
| XLogP | 1.02 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|