C12H16O4 — CID 100719829
(1S,2R,3R,4S)-7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylic acid (PubChem CID 100719829) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (1S,2R,3R,4S)-7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
| Compound Name | (1S,2R,3R,4S)-7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 100719829 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (1S,2R,3R,4S)-7-propan-2-ylidenebicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| SMILES | CC(C)=C1[C@H]2CC[C@H]1[C@@H](C(=O)O)[C@@H]2C(=O)O |
| InChI | InChI=1S/C12H16O4/c1-5(2)8-6-3-4-7(8)10(12(15)16)9(6)11(13)14/h6-7,9-10H,3-4H2,1-2H3,(H,13,14)(H,15,16)/t6-,7-,9-,10-/m1/s1 |
| InChIKey | POESARFBVDOHKT-KHUVANEUSA-N |
| XLogP | 1.76 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|