C19H20F2N2OS — CID 100719879
1-(2,6-difluorophenyl)-3-[(4R)-2,2,7-trimethyl-3,4-dihydrochromen-4-yl]thiourea (PubChem CID 100719879) has the molecular formula C19H20F2N2OS and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[(4R)-2,2,7-trimethyl-3,4-dihydrochromen-4-yl]thiourea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[(4R)-2,2,7-trimethyl-3,4-dihydrochromen-4-yl]thiourea |
|---|---|
| PubChem CID | 100719879 |
| Molecular Formula | C19H20F2N2OS |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[(4R)-2,2,7-trimethyl-3,4-dihydrochromen-4-yl]thiourea |
| SMILES | Cc1ccc2c(c1)OC(C)(C)C[C@H]2NC(=S)Nc1c(F)cccc1F |
| InChI | InChI=1S/C19H20F2N2OS/c1-11-7-8-12-15(10-19(2,3)24-16(12)9-11)22-18(25)23-17-13(20)5-4-6-14(17)21/h4-9,15H,10H2,1-3H3,(H2,22,23,25)/t15-/m1/s1 |
| InChIKey | HQGKLFXXYBPZOR-OAHLLOKOSA-N |
| XLogP | 4.86 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|