About (4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate
(4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 10072027) has the molecular formula C18H20BrNO5S
and a molecular weight of 442.33 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate.
Molecular Properties
| Compound Name | (4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
| PubChem CID | 10072027 |
| Molecular Formula | C18H20BrNO5S |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | COc1ccc(COC(=O)C(=C(C)C)N2C(=O)[C@H](Br)[C@H]2SC(C)=O)cc1 |
| InChI | InChI=1S/C18H20BrNO5S/c1-10(2)15(20-16(22)14(19)17(20)26-11(3)21)18(23)25-9-12-5-7-13(24-4)8-6-12/h5-8,14,17H,9H2,1-4H3/t14-,17+/m0/s1 |
| InChIKey | NRHKDHKJNIJPPC-WMLDXEAASA-N |
| XLogP | 3.24 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate?
The IUPAC name of (4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate (CID 10072027) is (4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate.
What is the SMILES notation for (4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate?
The canonical SMILES for (4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate is COc1ccc(COC(=O)C(=C(C)C)N2C(=O)[C@H](Br)[C@H]2SC(C)=O)cc1.
What is the InChIKey of (4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate?
The InChIKey is NRHKDHKJNIJPPC-WMLDXEAASA-N. The full InChI is InChI=1S/C18H20BrNO5S/c1-10(2)15(20-16(22)14(19)17(20)26-11(3)21)18(23)25-9-12-5-7-13(24-4)8-6-12/h5-8,14,17H,9H2,1-4H3/t14-,17+/m0/s1.
What are the key properties of (4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate?
(4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate has a molecular weight of 442.33 g/mol, XLogP of 3.24, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methyl 2-[(2R,3S)-2-acetylsulfanyl-3-bromo-4-oxoazetidin-1-yl]-3-methylbut-2-enoate is sourced from PubChem (CID 10072027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).