C20H19FN2O2 — CID 100721529
N-(2-cyano-4-methoxyphenyl)-1-(4-fluorophenyl)cyclopentane-1-carboxamide (PubChem CID 100721529) has the molecular formula C20H19FN2O2 and a molecular weight of 338.38 g/mol. Its IUPAC name is N-(2-cyano-4-methoxyphenyl)-1-(4-fluorophenyl)cyclopentane-1-carboxamide.
| Compound Name | N-(2-cyano-4-methoxyphenyl)-1-(4-fluorophenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 100721529 |
| Molecular Formula | C20H19FN2O2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-(2-cyano-4-methoxyphenyl)-1-(4-fluorophenyl)cyclopentane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(c3ccc(F)cc3)CCCC2)c(C#N)c1 |
| InChI | InChI=1S/C20H19FN2O2/c1-25-17-8-9-18(14(12-17)13-22)23-19(24)20(10-2-3-11-20)15-4-6-16(21)7-5-15/h4-9,12H,2-3,10-11H2,1H3,(H,23,24) |
| InChIKey | YUPOSZPJSVTNMC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |