C15H16F4N2O3 — CID 100721553
3-[(2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]-3-oxo-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 100721553) has the molecular formula C15H16F4N2O3 and a molecular weight of 348.30 g/mol. Its IUPAC name is 3-[(2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]-3-oxo-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 3-[(2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]-3-oxo-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 100721553 |
| Molecular Formula | C15H16F4N2O3 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 3-[(2R,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]-3-oxo-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | O=C(CC(=O)N1C[C@H](O)C[C@@H]1c1cccc(F)c1)NCC(F)(F)F |
| InChI | InChI=1S/C15H16F4N2O3/c16-10-3-1-2-9(4-10)12-5-11(22)7-21(12)14(24)6-13(23)20-8-15(17,18)19/h1-4,11-12,22H,5-8H2,(H,20,23)/t11-,12-/m1/s1 |
| InChIKey | GEUWTWVJDWWENG-VXGBXAGGSA-N |
| XLogP | 1.53 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|