C26H31N5OS — CID 100721592
3-[(4S,5S)-5-(1-tert-butylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methylphenyl)propanamide (PubChem CID 100721592) has the molecular formula C26H31N5OS and a molecular weight of 461.64 g/mol. Its IUPAC name is 3-[(4S,5S)-5-(1-tert-butylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methylphenyl)propanamide.
| Compound Name | 3-[(4S,5S)-5-(1-tert-butylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 100721592 |
| Molecular Formula | C26H31N5OS |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 3-[(4S,5S)-5-(1-tert-butylpyrrol-3-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-methylphenyl)propanamide |
| SMILES | Cc1ccccc1NC(=O)CCN1C(=S)N[C@H](c2ccccn2)[C@@H]1c1ccn(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H31N5OS/c1-18-9-5-6-10-20(18)28-22(32)13-16-31-24(19-12-15-30(17-19)26(2,3)4)23(29-25(31)33)21-11-7-8-14-27-21/h5-12,14-15,17,23-24H,13,16H2,1-4H3,(H,28,32)(H,29,33)/t23-,24+/m1/s1 |
| InChIKey | YCHIXQADFCSEFO-RPWUZVMVSA-N |
| XLogP | 4.95 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|