About N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide
N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide (PubChem CID 10072215) has the molecular formula C23H29F2N3O2Si
and a molecular weight of 445.59 g/mol. Its IUPAC name is N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide.
Molecular Properties
| Compound Name | N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide |
| PubChem CID | 10072215 |
| Molecular Formula | C23H29F2N3O2Si |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide |
| SMILES | CCCC(=O)Nc1nn(COCC[Si](C)(C)C)c2cc(-c3cc(F)cc(F)c3)ccc12 |
| InChI | InChI=1S/C23H29F2N3O2Si/c1-5-6-22(29)26-23-20-8-7-16(17-11-18(24)14-19(25)12-17)13-21(20)28(27-23)15-30-9-10-31(2,3)4/h7-8,11-14H,5-6,9-10,15H2,1-4H3,(H,26,27,29) |
| InChIKey | PBJMBODDUYVBDP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide?
The IUPAC name of N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide (CID 10072215) is N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide.
What is the SMILES notation for N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide?
The canonical SMILES for N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide is CCCC(=O)Nc1nn(COCC[Si](C)(C)C)c2cc(-c3cc(F)cc(F)c3)ccc12.
What is the InChIKey of N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide?
The InChIKey is PBJMBODDUYVBDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29F2N3O2Si/c1-5-6-22(29)26-23-20-8-7-16(17-11-18(24)14-19(25)12-17)13-21(20)28(27-23)15-30-9-10-31(2,3)4/h7-8,11-14H,5-6,9-10,15H2,1-4H3,(H,26,27,29).
What are the key properties of N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide?
N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide has a molecular weight of 445.59 g/mol, XLogP of 6.03, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(3,5-difluorophenyl)-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide is sourced from PubChem (CID 10072215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).