C20H16FN2O7P — CID 10072234
2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]oxyethylphosphonic acid (PubChem CID 10072234) has the molecular formula C20H16FN2O7P and a molecular weight of 446.33 g/mol. Its IUPAC name is 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]oxyethylphosphonic acid.
| Compound Name | 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]oxyethylphosphonic acid |
|---|---|
| PubChem CID | 10072234 |
| Molecular Formula | C20H16FN2O7P |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 2-[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl]oxyethylphosphonic acid |
| SMILES | O=C1c2c(c(O)c3ncccc3c2OCCP(=O)(O)O)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H16FN2O7P/c21-12-5-3-11(4-6-12)10-23-19(25)14-15(20(23)26)18(30-8-9-31(27,28)29)13-2-1-7-22-16(13)17(14)24/h1-7,24H,8-10H2,(H2,27,28,29) |
| InChIKey | CGKDVZCYQDZAPI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|