C23H24N6O2S — CID 10072355
3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N,N-bis(1H-imidazol-5-ylmethyl)aniline (PubChem CID 10072355) has the molecular formula C23H24N6O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N,N-bis(1H-imidazol-5-ylmethyl)aniline.
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N,N-bis(1H-imidazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 10072355 |
| Molecular Formula | C23H24N6O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)-N,N-bis(1H-imidazol-5-ylmethyl)aniline |
| SMILES | O=S(=O)(c1cccc(N(Cc2cnc[nH]2)Cc2cnc[nH]2)c1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C23H24N6O2S/c30-32(31,29-10-4-6-18-5-1-2-9-23(18)29)22-8-3-7-21(11-22)28(14-19-12-24-16-26-19)15-20-13-25-17-27-20/h1-3,5,7-9,11-13,16-17H,4,6,10,14-15H2,(H,24,26)(H,25,27) |
| InChIKey | ISXBYWANZZPSKD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |