C10H3ClF14N2 — CID 10072568
5-(7-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl)-1H-pyrazole (PubChem CID 10072568) has the molecular formula C10H3ClF14N2 and a molecular weight of 452.57 g/mol. Its IUPAC name is 5-(7-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl)-1H-pyrazole.
| Compound Name | 5-(7-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl)-1H-pyrazole |
|---|---|
| PubChem CID | 10072568 |
| Molecular Formula | C10H3ClF14N2 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 451.98 |
| IUPAC Name | 5-(7-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl)-1H-pyrazole |
| SMILES | FC(F)(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccn[nH]1 |
| InChI | InChI=1S/C10H3ClF14N2/c11-10(24,25)9(22,23)8(20,21)7(18,19)6(16,17)5(14,15)4(12,13)3-1-2-26-27-3/h1-2H,(H,26,27) |
| InChIKey | NFGPUOBZQTXPLM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|