C21H21N5O5S — CID 10072710
3-[4-(2-methoxyphenyl)-2,5-dioxopyrrol-3-yl]-1-[3-(sulfamoylamino)propyl]pyrrolo[2,3-b]pyridine (PubChem CID 10072710) has the molecular formula C21H21N5O5S and a molecular weight of 455.50 g/mol. Its IUPAC name is 3-[4-(2-methoxyphenyl)-2,5-dioxopyrrol-3-yl]-1-[3-(sulfamoylamino)propyl]pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[4-(2-methoxyphenyl)-2,5-dioxopyrrol-3-yl]-1-[3-(sulfamoylamino)propyl]pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 10072710 |
| Molecular Formula | C21H21N5O5S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 3-[4-(2-methoxyphenyl)-2,5-dioxopyrrol-3-yl]-1-[3-(sulfamoylamino)propyl]pyrrolo[2,3-b]pyridine |
| SMILES | COc1ccccc1C1=C(c2cn(CCCNS(N)(=O)=O)c3ncccc23)C(=O)NC1=O |
| InChI | InChI=1S/C21H21N5O5S/c1-31-16-8-3-2-6-14(16)17-18(21(28)25-20(17)27)15-12-26(11-5-10-24-32(22,29)30)19-13(15)7-4-9-23-19/h2-4,6-9,12,24H,5,10-11H2,1H3,(H2,22,29,30)(H,25,27,28) |
| InChIKey | IBTJHABKSWXSHB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|