C17H17N3O3S2 — CID 100727124
4-ethoxy-N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide (PubChem CID 100727124) has the molecular formula C17H17N3O3S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is 4-ethoxy-N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 100727124 |
| Molecular Formula | C17H17N3O3S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 4-ethoxy-N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2nnc(-c3ccc(C)cc3)s2)cc1 |
| InChI | InChI=1S/C17H17N3O3S2/c1-3-23-14-8-10-15(11-9-14)25(21,22)20-17-19-18-16(24-17)13-6-4-12(2)5-7-13/h4-11H,3H2,1-2H3,(H,19,20) |
| InChIKey | JUMGVZBMWJKQDF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |