C18H21N5O2 — CID 100727655
(3R,5R)-1-(9-ethylpurin-6-yl)-5-(3-methoxyphenyl)pyrrolidin-3-ol (PubChem CID 100727655) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is (3R,5R)-1-(9-ethylpurin-6-yl)-5-(3-methoxyphenyl)pyrrolidin-3-ol.
| Compound Name | (3R,5R)-1-(9-ethylpurin-6-yl)-5-(3-methoxyphenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 100727655 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (3R,5R)-1-(9-ethylpurin-6-yl)-5-(3-methoxyphenyl)pyrrolidin-3-ol |
| SMILES | CCn1cnc2c(N3C[C@H](O)C[C@@H]3c3cccc(OC)c3)ncnc21 |
| InChI | InChI=1S/C18H21N5O2/c1-3-22-11-21-16-17(22)19-10-20-18(16)23-9-13(24)8-15(23)12-5-4-6-14(7-12)25-2/h4-7,10-11,13,15,24H,3,8-9H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | KLFDRZDCPAMUOY-UKRRQHHQSA-N |
| XLogP | 2.17 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |