About 6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol
6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol (PubChem CID 10072818) has the molecular formula C28H27NO5
and a molecular weight of 457.53 g/mol. Its IUPAC name is 6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol.
Molecular Properties
| Compound Name | 6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol |
| PubChem CID | 10072818 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol |
| SMILES | Oc1ccc2c(c1)OC(c1ccc(OCCN3CCCCC3)cc1)c1c-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C28H27NO5/c30-19-6-10-22-24(16-19)34-28-23-11-7-20(31)17-25(23)33-27(26(22)28)18-4-8-21(9-5-18)32-15-14-29-12-2-1-3-13-29/h4-11,16-17,27,30-31H,1-3,12-15H2 |
| InChIKey | GZZGPSDJPCNNQC-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 75.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol?
The IUPAC name of 6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol (CID 10072818) is 6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol.
What is the SMILES notation for 6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol?
The canonical SMILES for 6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol is Oc1ccc2c(c1)OC(c1ccc(OCCN3CCCCC3)cc1)c1c-2oc2cc(O)ccc12.
What is the InChIKey of 6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol?
The InChIKey is GZZGPSDJPCNNQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27NO5/c30-19-6-10-22-24(16-19)34-28-23-11-7-20(31)17-25(23)33-27(26(22)28)18-4-8-21(9-5-18)32-15-14-29-12-2-1-3-13-29/h4-11,16-17,27,30-31H,1-3,12-15H2.
What are the key properties of 6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol?
6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol has a molecular weight of 457.53 g/mol, XLogP of 5.86, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol is sourced from PubChem (CID 10072818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).