C21H12F3N3O4S — CID 10072898
2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]spiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone (PubChem CID 10072898) has the molecular formula C21H12F3N3O4S and a molecular weight of 459.41 g/mol. Its IUPAC name is 2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]spiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone.
| Compound Name | 2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]spiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone |
|---|---|
| PubChem CID | 10072898 |
| Molecular Formula | C21H12F3N3O4S |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]spiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone |
| SMILES | O=C1CC2(C(=O)N1)C(=O)N(Cc1nc3cc(C(F)(F)F)ccc3s1)C(=O)c1ccccc12 |
| InChI | InChI=1S/C21H12F3N3O4S/c22-21(23,24)10-5-6-14-13(7-10)25-16(32-14)9-27-17(29)11-3-1-2-4-12(11)20(19(27)31)8-15(28)26-18(20)30/h1-7H,8-9H2,(H,26,28,30) |
| InChIKey | PQQXXUSIXVOGFT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|