C15H16BrNO3S — CID 100729224
N-(2-bromophenyl)-4-methoxy-2,5-dimethylbenzenesulfonamide (PubChem CID 100729224) has the molecular formula C15H16BrNO3S and a molecular weight of 370.27 g/mol. Its IUPAC name is N-(2-bromophenyl)-4-methoxy-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-(2-bromophenyl)-4-methoxy-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 100729224 |
| Molecular Formula | C15H16BrNO3S |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | N-(2-bromophenyl)-4-methoxy-2,5-dimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)Nc2ccccc2Br)cc1C |
| InChI | InChI=1S/C15H16BrNO3S/c1-10-9-15(11(2)8-14(10)20-3)21(18,19)17-13-7-5-4-6-12(13)16/h4-9,17H,1-3H3 |
| InChIKey | RUQJOAKBMVSCDA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |