C15H16ClFN2O2S — CID 100730566
1-[(2R)-2-(5-chlorothiophen-2-yl)-2-methoxyethyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 100730566) has the molecular formula C15H16ClFN2O2S and a molecular weight of 342.82 g/mol. Its IUPAC name is 1-[(2R)-2-(5-chlorothiophen-2-yl)-2-methoxyethyl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[(2R)-2-(5-chlorothiophen-2-yl)-2-methoxyethyl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 100730566 |
| Molecular Formula | C15H16ClFN2O2S |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 1-[(2R)-2-(5-chlorothiophen-2-yl)-2-methoxyethyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | CO[C@H](CNC(=O)NCc1ccc(F)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H16ClFN2O2S/c1-21-12(13-6-7-14(16)22-13)9-19-15(20)18-8-10-2-4-11(17)5-3-10/h2-7,12H,8-9H2,1H3,(H2,18,19,20)/t12-/m1/s1 |
| InChIKey | AQIQWSJJXFAEJH-GFCCVEGCSA-N |
| XLogP | 3.73 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |