C24H32N2O5 — CID 100732243
(2S)-2-[benzyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-N-propan-2-ylbutanamide (PubChem CID 100732243) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is (2S)-2-[benzyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-N-propan-2-ylbutanamide.
| Compound Name | (2S)-2-[benzyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 100732243 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | (2S)-2-[benzyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-N-propan-2-ylbutanamide |
| SMILES | CC[C@@H](C(=O)NC(C)C)N(Cc1ccccc1)C(=O)COc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C24H32N2O5/c1-6-22(24(28)25-17(2)3)26(15-18-10-8-7-9-11-18)23(27)16-31-21-13-19(29-4)12-20(14-21)30-5/h7-14,17,22H,6,15-16H2,1-5H3,(H,25,28)/t22-/m0/s1 |
| InChIKey | LPNYBEUJCYFEDY-QFIPXVFZSA-N |
| XLogP | 3.41 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |