C19H21NO3 — CID 100733384
methyl 1-[(1R,5R)-3-phenyl-8-azabicyclo[3.2.1]oct-2-ene-8-carbonyl]cyclopropane-1-carboxylate (PubChem CID 100733384) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is methyl 1-[(1R,5R)-3-phenyl-8-azabicyclo[3.2.1]oct-2-ene-8-carbonyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[(1R,5R)-3-phenyl-8-azabicyclo[3.2.1]oct-2-ene-8-carbonyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 100733384 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | methyl 1-[(1R,5R)-3-phenyl-8-azabicyclo[3.2.1]oct-2-ene-8-carbonyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(C(=O)N2[C@@H]3CC[C@@H]2C=C(c2ccccc2)C3)CC1 |
| InChI | InChI=1S/C19H21NO3/c1-23-18(22)19(9-10-19)17(21)20-15-7-8-16(20)12-14(11-15)13-5-3-2-4-6-13/h2-6,11,15-16H,7-10,12H2,1H3/t15-,16-/m1/s1 |
| InChIKey | ZBEYYOQLQRWLMA-HZPDHXFCSA-N |
| XLogP | 2.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|